C14H21N — CID 118480671
1,1,3,5,7-pentamethyl-2,3-dihydroinden-4-amine (PubChem CID 118480671) has the molecular formula C14H21N and a molecular weight of 203.33 g/mol. Its IUPAC name is 1,1,3,5,7-pentamethyl-2,3-dihydroinden-4-amine.
| Compound Name | 1,1,3,5,7-pentamethyl-2,3-dihydroinden-4-amine |
|---|---|
| PubChem CID | 118480671 |
| Molecular Formula | C14H21N |
| Molecular Weight | 203.33 g/mol |
| Exact Mass | 203.17 |
| IUPAC Name | 1,1,3,5,7-pentamethyl-2,3-dihydroinden-4-amine |
| SMILES | Cc1cc(C)c2c(c1N)C(C)CC2(C)C |
| InChI | InChI=1S/C14H21N/c1-8-6-9(2)13(15)11-10(3)7-14(4,5)12(8)11/h6,10H,7,15H2,1-5H3 |
| InChIKey | JFECLCFJQIZGIL-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.33 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|