C25H16F5N5O2 — CID 118480859
1-[3-fluoro-4-[7-(5-methyl-1H-imidazol-2-yl)-1-oxo-2,3-dihydroisoindol-4-yl]phenyl]-3-(2,3,5,6-tetrafluorophenyl)urea (PubChem CID 118480859) has the molecular formula C25H16F5N5O2 and a molecular weight of 513.43 g/mol. Its IUPAC name is 1-[3-fluoro-4-[7-(5-methyl-1H-imidazol-2-yl)-1-oxo-2,3-dihydroisoindol-4-yl]phenyl]-3-(2,3,5,6-tetrafluorophenyl)urea.
| Compound Name | 1-[3-fluoro-4-[7-(5-methyl-1H-imidazol-2-yl)-1-oxo-2,3-dihydroisoindol-4-yl]phenyl]-3-(2,3,5,6-tetrafluorophenyl)urea |
|---|---|
| PubChem CID | 118480859 |
| Molecular Formula | C25H16F5N5O2 |
| Molecular Weight | 513.43 g/mol |
| Exact Mass | 513.12 |
| IUPAC Name | 1-[3-fluoro-4-[7-(5-methyl-1H-imidazol-2-yl)-1-oxo-2,3-dihydroisoindol-4-yl]phenyl]-3-(2,3,5,6-tetrafluorophenyl)urea |
| SMILES | Cc1cnc(-c2ccc(-c3ccc(NC(=O)Nc4c(F)c(F)cc(F)c4F)cc3F)c3c2C(=O)NC3)[nH]1 |
| InChI | InChI=1S/C25H16F5N5O2/c1-10-8-31-23(33-10)14-5-4-12(15-9-32-24(36)19(14)15)13-3-2-11(6-16(13)26)34-25(37)35-22-20(29)17(27)7-18(28)21(22)30/h2-8H,9H2,1H3,(H,31,33)(H,32,36)(H2,34,35,37) |
| InChIKey | JAKLHEYGHNGGEU-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 98.91 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.43 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|