C25H17F4N5O2 — CID 118480996
1-[3-fluoro-4-[7-(5-methyl-1H-imidazol-2-yl)-1-oxo-2,3-dihydroisoindol-4-yl]phenyl]-3-(2,3,6-trifluorophenyl)urea (PubChem CID 118480996) has the molecular formula C25H17F4N5O2 and a molecular weight of 495.44 g/mol. Its IUPAC name is 1-[3-fluoro-4-[7-(5-methyl-1H-imidazol-2-yl)-1-oxo-2,3-dihydroisoindol-4-yl]phenyl]-3-(2,3,6-trifluorophenyl)urea.
| Compound Name | 1-[3-fluoro-4-[7-(5-methyl-1H-imidazol-2-yl)-1-oxo-2,3-dihydroisoindol-4-yl]phenyl]-3-(2,3,6-trifluorophenyl)urea |
|---|---|
| PubChem CID | 118480996 |
| Molecular Formula | C25H17F4N5O2 |
| Molecular Weight | 495.44 g/mol |
| Exact Mass | 495.13 |
| IUPAC Name | 1-[3-fluoro-4-[7-(5-methyl-1H-imidazol-2-yl)-1-oxo-2,3-dihydroisoindol-4-yl]phenyl]-3-(2,3,6-trifluorophenyl)urea |
| SMILES | Cc1cnc(-c2ccc(-c3ccc(NC(=O)Nc4c(F)ccc(F)c4F)cc3F)c3c2C(=O)NC3)[nH]1 |
| InChI | InChI=1S/C25H17F4N5O2/c1-11-9-30-23(32-11)15-5-4-13(16-10-31-24(35)20(15)16)14-3-2-12(8-19(14)28)33-25(36)34-22-18(27)7-6-17(26)21(22)29/h2-9H,10H2,1H3,(H,30,32)(H,31,35)(H2,33,34,36) |
| InChIKey | AFMAJBGIKKZNNT-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 98.91 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.44 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|