C27H33N5O3S — CID 118481206
N'-[5-(4-tert-butylphenyl)sulfonylpyrrolo[2,3-b]pyrazin-2-yl]adamantane-2-carbohydrazide (PubChem CID 118481206) has the molecular formula C27H33N5O3S and a molecular weight of 507.66 g/mol. Its IUPAC name is N'-[5-(4-tert-butylphenyl)sulfonylpyrrolo[2,3-b]pyrazin-2-yl]adamantane-2-carbohydrazide.
| Compound Name | N'-[5-(4-tert-butylphenyl)sulfonylpyrrolo[2,3-b]pyrazin-2-yl]adamantane-2-carbohydrazide |
|---|---|
| PubChem CID | 118481206 |
| Molecular Formula | C27H33N5O3S |
| Molecular Weight | 507.66 g/mol |
| Exact Mass | 507.23 |
| IUPAC Name | N'-[5-(4-tert-butylphenyl)sulfonylpyrrolo[2,3-b]pyrazin-2-yl]adamantane-2-carbohydrazide |
| SMILES | CC(C)(C)c1ccc(S(=O)(=O)n2ccc3nc(NNC(=O)C4C5CC6CC(C5)CC4C6)cnc32)cc1 |
| InChI | InChI=1S/C27H33N5O3S/c1-27(2,3)20-4-6-21(7-5-20)36(34,35)32-9-8-22-25(32)28-15-23(29-22)30-31-26(33)24-18-11-16-10-17(13-18)14-19(24)12-16/h4-9,15-19,24H,10-14H2,1-3H3,(H,29,30)(H,31,33) |
| InChIKey | GRQZOWIXNWJDLE-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 105.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.66 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|