C26H26N6O4S2 — CID 118481405
N-[(1S,3R)-3-[5-(4-methylphenyl)sulfonyl-1,5,7,10,11-pentazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-12-yl]cyclopentyl]-1-phenylmethanesulfonamide (PubChem CID 118481405) has the molecular formula C26H26N6O4S2 and a molecular weight of 550.67 g/mol. Its IUPAC name is N-[(1S,3R)-3-[5-(4-methylphenyl)sulfonyl-1,5,7,10,11-pentazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-12-yl]cyclopentyl]-1-phenylmethanesulfonamide.
| Compound Name | N-[(1S,3R)-3-[5-(4-methylphenyl)sulfonyl-1,5,7,10,11-pentazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-12-yl]cyclopentyl]-1-phenylmethanesulfonamide |
|---|---|
| PubChem CID | 118481405 |
| Molecular Formula | C26H26N6O4S2 |
| Molecular Weight | 550.67 g/mol |
| Exact Mass | 550.15 |
| IUPAC Name | N-[(1S,3R)-3-[5-(4-methylphenyl)sulfonyl-1,5,7,10,11-pentazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-12-yl]cyclopentyl]-1-phenylmethanesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)n2ccc3c2ncc2nnc([C@@H]4CC[C@H](NS(=O)(=O)Cc5ccccc5)C4)n23)cc1 |
| InChI | InChI=1S/C26H26N6O4S2/c1-18-7-11-22(12-8-18)38(35,36)31-14-13-23-26(31)27-16-24-28-29-25(32(23)24)20-9-10-21(15-20)30-37(33,34)17-19-5-3-2-4-6-19/h2-8,11-14,16,20-21,30H,9-10,15,17H2,1H3/t20-,21+/m1/s1 |
| InChIKey | VQCARCFCAUSDDJ-RTWAWAEBSA-N |
| XLogP | 3.38 |
| TPSA | 128.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.67 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |