C31H40N2O7 — CID 11848168
(2R,3R,4R)-3,4-dihydroxy-N-[(1S,2R)-2-hydroxy-2,3-dihydro-1H-inden-1-yl]-4-[(2R,11E)-3-oxo-1-oxa-4-azacyclotridec-11-en-2-yl]-2-phenylmethoxybutanamide (PubChem CID 11848168) has the molecular formula C31H40N2O7 and a molecular weight of 552.67 g/mol. Its IUPAC name is (2R,3R,4R)-3,4-dihydroxy-N-[(1S,2R)-2-hydroxy-2,3-dihydro-1H-inden-1-yl]-4-[(2R,11E)-3-oxo-1-oxa-4-azacyclotridec-11-en-2-yl]-2-phenylmethoxybutanamide.
| Compound Name | (2R,3R,4R)-3,4-dihydroxy-N-[(1S,2R)-2-hydroxy-2,3-dihydro-1H-inden-1-yl]-4-[(2R,11E)-3-oxo-1-oxa-4-azacyclotridec-11-en-2-yl]-2-phenylmethoxybutanamide |
|---|---|
| PubChem CID | 11848168 |
| Molecular Formula | C31H40N2O7 |
| Molecular Weight | 552.67 g/mol |
| Exact Mass | 552.28 |
| IUPAC Name | (2R,3R,4R)-3,4-dihydroxy-N-[(1S,2R)-2-hydroxy-2,3-dihydro-1H-inden-1-yl]-4-[(2R,11E)-3-oxo-1-oxa-4-azacyclotridec-11-en-2-yl]-2-phenylmethoxybutanamide |
| SMILES | O=C1NCCCCCC/C=C/CO[C@@H]1[C@H](O)[C@@H](O)[C@@H](OCc1ccccc1)C(=O)N[C@H]1c2ccccc2C[C@H]1O |
| InChI | InChI=1S/C31H40N2O7/c34-24-19-22-15-9-10-16-23(22)25(24)33-31(38)29(40-20-21-13-7-6-8-14-21)27(36)26(35)28-30(37)32-17-11-4-2-1-3-5-12-18-39-28/h5-10,12-16,24-29,34-36H,1-4,11,17-20H2,(H,32,37)(H,33,38)/b12-5+/t24-,25+,26-,27-,28-,29-/m1/s1 |
| InChIKey | JPWJSGBRRUJZFX-SBMOPXESSA-N |
| XLogP | 2.09 |
| TPSA | 137.35 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.67 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|