About N,N-diethylethanamine;N-ethylethanamine;propan-2-amine
N,N-diethylethanamine;N-ethylethanamine;propan-2-amine (PubChem CID 118481680) has the molecular formula C13H35N3
and a molecular weight of 233.44 g/mol. Its IUPAC name is N,N-diethylethanamine;N-ethylethanamine;propan-2-amine.
Molecular Properties
| Compound Name | N,N-diethylethanamine;N-ethylethanamine;propan-2-amine |
| PubChem CID | 118481680 |
| Molecular Formula | C13H35N3 |
| Molecular Weight | 233.44 g/mol |
| Exact Mass | 233.28 |
| IUPAC Name | N,N-diethylethanamine;N-ethylethanamine;propan-2-amine |
| SMILES | CC(C)N.CCN(CC)CC.CCNCC |
| InChI | InChI=1S/C6H15N.C4H11N.C3H9N/c1-4-7(5-2)6-3;1-3-5-4-2;1-3(2)4/h4-6H2,1-3H3;5H,3-4H2,1-2H3;3H,4H2,1-2H3 |
| InChIKey | CVPKHEWXOWWVGG-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.44 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N,N-diethylethanamine;N-ethylethanamine;propan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-diethylethanamine;N-ethylethanamine;propan-2-amine?
The IUPAC name of N,N-diethylethanamine;N-ethylethanamine;propan-2-amine (CID 118481680) is N,N-diethylethanamine;N-ethylethanamine;propan-2-amine.
What is the SMILES notation for N,N-diethylethanamine;N-ethylethanamine;propan-2-amine?
The canonical SMILES for N,N-diethylethanamine;N-ethylethanamine;propan-2-amine is CC(C)N.CCN(CC)CC.CCNCC.
What is the InChIKey of N,N-diethylethanamine;N-ethylethanamine;propan-2-amine?
The InChIKey is CVPKHEWXOWWVGG-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H15N.C4H11N.C3H9N/c1-4-7(5-2)6-3;1-3-5-4-2;1-3(2)4/h4-6H2,1-3H3;5H,3-4H2,1-2H3;3H,4H2,1-2H3.
What are the key properties of N,N-diethylethanamine;N-ethylethanamine;propan-2-amine?
N,N-diethylethanamine;N-ethylethanamine;propan-2-amine has a molecular weight of 233.44 g/mol, XLogP of 2.32, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-diethylethanamine;N-ethylethanamine;propan-2-amine is sourced from PubChem (CID 118481680), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).