C21H21ClFN3O — CID 118481723
(1S)-2-[(11cR)-10-chloro-8-fluoro-1,2,3,5,6,11c-hexahydroindolizino[7,8-b]indol-7-yl]-1-pyridin-3-ylethanol (PubChem CID 118481723) has the molecular formula C21H21ClFN3O and a molecular weight of 385.87 g/mol. Its IUPAC name is (1S)-2-[(11cR)-10-chloro-8-fluoro-1,2,3,5,6,11c-hexahydroindolizino[7,8-b]indol-7-yl]-1-pyridin-3-ylethanol.
| Compound Name | (1S)-2-[(11cR)-10-chloro-8-fluoro-1,2,3,5,6,11c-hexahydroindolizino[7,8-b]indol-7-yl]-1-pyridin-3-ylethanol |
|---|---|
| PubChem CID | 118481723 |
| Molecular Formula | C21H21ClFN3O |
| Molecular Weight | 385.87 g/mol |
| Exact Mass | 385.14 |
| IUPAC Name | (1S)-2-[(11cR)-10-chloro-8-fluoro-1,2,3,5,6,11c-hexahydroindolizino[7,8-b]indol-7-yl]-1-pyridin-3-ylethanol |
| SMILES | O[C@H](Cn1c2c(c3cc(Cl)cc(F)c31)[C@H]1CCCN1CC2)c1cccnc1 |
| InChI | InChI=1S/C21H21ClFN3O/c22-14-9-15-20-17-4-2-7-25(17)8-5-18(20)26(21(15)16(23)10-14)12-19(27)13-3-1-6-24-11-13/h1,3,6,9-11,17,19,27H,2,4-5,7-8,12H2/t17-,19-/m1/s1 |
| InChIKey | KNVLTTAWHLNJNL-IEBWSBKVSA-N |
| XLogP | 4.26 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.87 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|