C24H27N3O3 — CID 118481762
ethyl 7-(2-hydroxy-2-pyridin-4-ylethyl)-1,2,3,5,6,11c-hexahydroindolizino[7,8-b]indole-10-carboxylate (PubChem CID 118481762) has the molecular formula C24H27N3O3 and a molecular weight of 405.50 g/mol. Its IUPAC name is ethyl 7-(2-hydroxy-2-pyridin-4-ylethyl)-1,2,3,5,6,11c-hexahydroindolizino[7,8-b]indole-10-carboxylate.
| Compound Name | ethyl 7-(2-hydroxy-2-pyridin-4-ylethyl)-1,2,3,5,6,11c-hexahydroindolizino[7,8-b]indole-10-carboxylate |
|---|---|
| PubChem CID | 118481762 |
| Molecular Formula | C24H27N3O3 |
| Molecular Weight | 405.50 g/mol |
| Exact Mass | 405.21 |
| IUPAC Name | ethyl 7-(2-hydroxy-2-pyridin-4-ylethyl)-1,2,3,5,6,11c-hexahydroindolizino[7,8-b]indole-10-carboxylate |
| SMILES | CCOC(=O)c1ccc2c(c1)c1c(n2CC(O)c2ccncc2)CCN2CCCC12 |
| InChI | InChI=1S/C24H27N3O3/c1-2-30-24(29)17-5-6-19-18(14-17)23-20-4-3-12-26(20)13-9-21(23)27(19)15-22(28)16-7-10-25-11-8-16/h5-8,10-11,14,20,22,28H,2-4,9,12-13,15H2,1H3 |
| InChIKey | YMYOQQGQMBSDDO-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.50 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|