C28H35N3O — CID 118481786
(11cR)-7-[(2S)-2-(cyclobutylmethoxy)-2-pyridin-4-ylethyl]-8,10-dimethyl-1,2,3,5,6,11c-hexahydroindolizino[7,8-b]indole (PubChem CID 118481786) has the molecular formula C28H35N3O and a molecular weight of 429.61 g/mol. Its IUPAC name is (11cR)-7-[(2S)-2-(cyclobutylmethoxy)-2-pyridin-4-ylethyl]-8,10-dimethyl-1,2,3,5,6,11c-hexahydroindolizino[7,8-b]indole.
| Compound Name | (11cR)-7-[(2S)-2-(cyclobutylmethoxy)-2-pyridin-4-ylethyl]-8,10-dimethyl-1,2,3,5,6,11c-hexahydroindolizino[7,8-b]indole |
|---|---|
| PubChem CID | 118481786 |
| Molecular Formula | C28H35N3O |
| Molecular Weight | 429.61 g/mol |
| Exact Mass | 429.28 |
| IUPAC Name | (11cR)-7-[(2S)-2-(cyclobutylmethoxy)-2-pyridin-4-ylethyl]-8,10-dimethyl-1,2,3,5,6,11c-hexahydroindolizino[7,8-b]indole |
| SMILES | Cc1cc(C)c2c(c1)c1c(n2C[C@@H](OCC2CCC2)c2ccncc2)CCN2CCC[C@H]12 |
| InChI | InChI=1S/C28H35N3O/c1-19-15-20(2)28-23(16-19)27-24-7-4-13-30(24)14-10-25(27)31(28)17-26(22-8-11-29-12-9-22)32-18-21-5-3-6-21/h8-9,11-12,15-16,21,24,26H,3-7,10,13-14,17-18H2,1-2H3/t24-,26-/m1/s1 |
| InChIKey | PFEWFXQMKMLQEX-AOYPEHQESA-N |
| XLogP | 5.90 |
| TPSA | 30.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.61 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|