C27H33N3O — CID 118481797
(11cR)-7-[2-(cyclobutylmethoxy)-2-pyridin-4-ylethyl]-10-methyl-1,2,3,5,6,11c-hexahydroindolizino[7,8-b]indole (PubChem CID 118481797) has the molecular formula C27H33N3O and a molecular weight of 415.58 g/mol. Its IUPAC name is (11cR)-7-[2-(cyclobutylmethoxy)-2-pyridin-4-ylethyl]-10-methyl-1,2,3,5,6,11c-hexahydroindolizino[7,8-b]indole.
| Compound Name | (11cR)-7-[2-(cyclobutylmethoxy)-2-pyridin-4-ylethyl]-10-methyl-1,2,3,5,6,11c-hexahydroindolizino[7,8-b]indole |
|---|---|
| PubChem CID | 118481797 |
| Molecular Formula | C27H33N3O |
| Molecular Weight | 415.58 g/mol |
| Exact Mass | 415.26 |
| IUPAC Name | (11cR)-7-[2-(cyclobutylmethoxy)-2-pyridin-4-ylethyl]-10-methyl-1,2,3,5,6,11c-hexahydroindolizino[7,8-b]indole |
| SMILES | Cc1ccc2c(c1)c1c(n2CC(OCC2CCC2)c2ccncc2)CCN2CCC[C@H]12 |
| InChI | InChI=1S/C27H33N3O/c1-19-7-8-23-22(16-19)27-24-6-3-14-29(24)15-11-25(27)30(23)17-26(21-9-12-28-13-10-21)31-18-20-4-2-5-20/h7-10,12-13,16,20,24,26H,2-6,11,14-15,17-18H2,1H3/t24-,26?/m1/s1 |
| InChIKey | WFDRTHFQGFURHQ-RMVMEJTISA-N |
| XLogP | 5.60 |
| TPSA | 30.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.58 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|