C16H20N2O — CID 118481806
(11cR)-9-methoxy-10-methyl-2,3,5,6,7,11c-hexahydro-1H-indolizino[7,8-b]indole (PubChem CID 118481806) has the molecular formula C16H20N2O and a molecular weight of 256.35 g/mol. Its IUPAC name is (11cR)-9-methoxy-10-methyl-2,3,5,6,7,11c-hexahydro-1H-indolizino[7,8-b]indole.
| Compound Name | (11cR)-9-methoxy-10-methyl-2,3,5,6,7,11c-hexahydro-1H-indolizino[7,8-b]indole |
|---|---|
| PubChem CID | 118481806 |
| Molecular Formula | C16H20N2O |
| Molecular Weight | 256.35 g/mol |
| Exact Mass | 256.16 |
| IUPAC Name | (11cR)-9-methoxy-10-methyl-2,3,5,6,7,11c-hexahydro-1H-indolizino[7,8-b]indole |
| SMILES | COc1cc2[nH]c3c(c2cc1C)[C@H]1CCCN1CC3 |
| InChI | InChI=1S/C16H20N2O/c1-10-8-11-13(9-15(10)19-2)17-12-5-7-18-6-3-4-14(18)16(11)12/h8-9,14,17H,3-7H2,1-2H3/t14-/m1/s1 |
| InChIKey | MEVZVDAFNOQEJR-CQSZACIVSA-N |
| XLogP | 3.18 |
| TPSA | 28.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.35 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|