About 5-bromo-6-fluoro-2,3-dihydro-1H-isoindole;hydrochloride
5-bromo-6-fluoro-2,3-dihydro-1H-isoindole;hydrochloride (PubChem CID 118482500) has the molecular formula C8H8BrClFN
and a molecular weight of 252.51 g/mol. Its IUPAC name is 5-bromo-6-fluoro-2,3-dihydro-1H-isoindole;hydrochloride.
Molecular Properties
| Compound Name | 5-bromo-6-fluoro-2,3-dihydro-1H-isoindole;hydrochloride |
| PubChem CID | 118482500 |
| Molecular Formula | C8H8BrClFN |
| Molecular Weight | 252.51 g/mol |
| Exact Mass | 250.95 |
| IUPAC Name | 5-bromo-6-fluoro-2,3-dihydro-1H-isoindole;hydrochloride |
| SMILES | Cl.Fc1cc2c(cc1Br)CNC2 |
| InChI | InChI=1S/C8H7BrFN.ClH/c9-7-1-5-3-11-4-6(5)2-8(7)10;/h1-2,11H,3-4H2;1H |
| InChIKey | ACOGAZHNBUMGGS-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.51 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 5-bromo-6-fluoro-2,3-dihydro-1H-isoindole;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-6-fluoro-2,3-dihydro-1H-isoindole;hydrochloride?
The IUPAC name of 5-bromo-6-fluoro-2,3-dihydro-1H-isoindole;hydrochloride (CID 118482500) is 5-bromo-6-fluoro-2,3-dihydro-1H-isoindole;hydrochloride.
What is the SMILES notation for 5-bromo-6-fluoro-2,3-dihydro-1H-isoindole;hydrochloride?
The canonical SMILES for 5-bromo-6-fluoro-2,3-dihydro-1H-isoindole;hydrochloride is Cl.Fc1cc2c(cc1Br)CNC2.
What is the InChIKey of 5-bromo-6-fluoro-2,3-dihydro-1H-isoindole;hydrochloride?
The InChIKey is ACOGAZHNBUMGGS-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7BrFN.ClH/c9-7-1-5-3-11-4-6(5)2-8(7)10;/h1-2,11H,3-4H2;1H.
What are the key properties of 5-bromo-6-fluoro-2,3-dihydro-1H-isoindole;hydrochloride?
5-bromo-6-fluoro-2,3-dihydro-1H-isoindole;hydrochloride has a molecular weight of 252.51 g/mol, XLogP of 2.61, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-6-fluoro-2,3-dihydro-1H-isoindole;hydrochloride is sourced from PubChem (CID 118482500), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).