C20H26N4O4 — CID 118482519
1,2-bis(6-morpholin-4-yl-3-pyridinyl)ethane-1,2-diol (PubChem CID 118482519) has the molecular formula C20H26N4O4 and a molecular weight of 386.45 g/mol. Its IUPAC name is 1,2-bis(6-morpholin-4-yl-3-pyridinyl)ethane-1,2-diol.
| Compound Name | 1,2-bis(6-morpholin-4-yl-3-pyridinyl)ethane-1,2-diol |
|---|---|
| PubChem CID | 118482519 |
| Molecular Formula | C20H26N4O4 |
| Molecular Weight | 386.45 g/mol |
| Exact Mass | 386.20 |
| IUPAC Name | 1,2-bis(6-morpholin-4-yl-3-pyridinyl)ethane-1,2-diol |
| SMILES | OC(c1ccc(N2CCOCC2)nc1)C(O)c1ccc(N2CCOCC2)nc1 |
| InChI | InChI=1S/C20H26N4O4/c25-19(15-1-3-17(21-13-15)23-5-9-27-10-6-23)20(26)16-2-4-18(22-14-16)24-7-11-28-12-8-24/h1-4,13-14,19-20,25-26H,5-12H2 |
| InChIKey | XIFRTIKRXZCXNT-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 91.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.45 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |