C22H33NO6 — CID 118482741
4-benzyl-3-[2-[2-(2-methoxyethoxymethoxy)ethyl]-3,3-dimethylbutanoyl]-1,3-oxazolidin-2-one (PubChem CID 118482741) has the molecular formula C22H33NO6 and a molecular weight of 407.51 g/mol. Its IUPAC name is 4-benzyl-3-[2-[2-(2-methoxyethoxymethoxy)ethyl]-3,3-dimethylbutanoyl]-1,3-oxazolidin-2-one.
| Compound Name | 4-benzyl-3-[2-[2-(2-methoxyethoxymethoxy)ethyl]-3,3-dimethylbutanoyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 118482741 |
| Molecular Formula | C22H33NO6 |
| Molecular Weight | 407.51 g/mol |
| Exact Mass | 407.23 |
| IUPAC Name | 4-benzyl-3-[2-[2-(2-methoxyethoxymethoxy)ethyl]-3,3-dimethylbutanoyl]-1,3-oxazolidin-2-one |
| SMILES | COCCOCOCCC(C(=O)N1C(=O)OCC1Cc1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C22H33NO6/c1-22(2,3)19(10-11-27-16-28-13-12-26-4)20(24)23-18(15-29-21(23)25)14-17-8-6-5-7-9-17/h5-9,18-19H,10-16H2,1-4H3 |
| InChIKey | OJWGCWCDNLZFLH-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 74.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.51 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|