C8H8F4O3 — CID 118482929
3-methyl-1-(2,2,4,4-tetrafluorooxetan-3-yl)oxybut-3-en-2-one (PubChem CID 118482929) has the molecular formula C8H8F4O3 and a molecular weight of 228.14 g/mol. Its IUPAC name is 3-methyl-1-(2,2,4,4-tetrafluorooxetan-3-yl)oxybut-3-en-2-one.
| Compound Name | 3-methyl-1-(2,2,4,4-tetrafluorooxetan-3-yl)oxybut-3-en-2-one |
|---|---|
| PubChem CID | 118482929 |
| Molecular Formula | C8H8F4O3 |
| Molecular Weight | 228.14 g/mol |
| Exact Mass | 228.04 |
| IUPAC Name | 3-methyl-1-(2,2,4,4-tetrafluorooxetan-3-yl)oxybut-3-en-2-one |
| SMILES | C=C(C)C(=O)COC1C(F)(F)OC1(F)F |
| InChI | InChI=1S/C8H8F4O3/c1-4(2)5(13)3-14-6-7(9,10)15-8(6,11)12/h6H,1,3H2,2H3 |
| InChIKey | VQYZVBGBGXTMKG-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.14 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|