C11H13F5O3 — CID 118482941
2-methyl-4-[2-(1,1,2,2,2-pentafluoroethyl)oxetan-3-yl]oxypent-1-en-3-one (PubChem CID 118482941) has the molecular formula C11H13F5O3 and a molecular weight of 288.21 g/mol. Its IUPAC name is 2-methyl-4-[2-(1,1,2,2,2-pentafluoroethyl)oxetan-3-yl]oxypent-1-en-3-one.
| Compound Name | 2-methyl-4-[2-(1,1,2,2,2-pentafluoroethyl)oxetan-3-yl]oxypent-1-en-3-one |
|---|---|
| PubChem CID | 118482941 |
| Molecular Formula | C11H13F5O3 |
| Molecular Weight | 288.21 g/mol |
| Exact Mass | 288.08 |
| IUPAC Name | 2-methyl-4-[2-(1,1,2,2,2-pentafluoroethyl)oxetan-3-yl]oxypent-1-en-3-one |
| SMILES | C=C(C)C(=O)C(C)OC1COC1C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C11H13F5O3/c1-5(2)8(17)6(3)19-7-4-18-9(7)10(12,13)11(14,15)16/h6-7,9H,1,4H2,2-3H3 |
| InChIKey | REKDTDIYKDDXRB-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.21 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|