About 5-(2,2-difluorooxetan-3-yl)oxy-2-methylpent-1-en-3-one
5-(2,2-difluorooxetan-3-yl)oxy-2-methylpent-1-en-3-one (PubChem CID 118482953) has the molecular formula C9H12F2O3
and a molecular weight of 206.19 g/mol. Its IUPAC name is 5-(2,2-difluorooxetan-3-yl)oxy-2-methylpent-1-en-3-one.
Molecular Properties
| Compound Name | 5-(2,2-difluorooxetan-3-yl)oxy-2-methylpent-1-en-3-one |
| PubChem CID | 118482953 |
| Molecular Formula | C9H12F2O3 |
| Molecular Weight | 206.19 g/mol |
| Exact Mass | 206.08 |
| IUPAC Name | 5-(2,2-difluorooxetan-3-yl)oxy-2-methylpent-1-en-3-one |
| SMILES | C=C(C)C(=O)CCOC1COC1(F)F |
| InChI | InChI=1S/C9H12F2O3/c1-6(2)7(12)3-4-13-8-5-14-9(8,10)11/h8H,1,3-5H2,2H3 |
| InChIKey | HYCCMJRHIQVILG-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.19 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 5-(2,2-difluorooxetan-3-yl)oxy-2-methylpent-1-en-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(2,2-difluorooxetan-3-yl)oxy-2-methylpent-1-en-3-one?
The IUPAC name of 5-(2,2-difluorooxetan-3-yl)oxy-2-methylpent-1-en-3-one (CID 118482953) is 5-(2,2-difluorooxetan-3-yl)oxy-2-methylpent-1-en-3-one.
What is the SMILES notation for 5-(2,2-difluorooxetan-3-yl)oxy-2-methylpent-1-en-3-one?
The canonical SMILES for 5-(2,2-difluorooxetan-3-yl)oxy-2-methylpent-1-en-3-one is C=C(C)C(=O)CCOC1COC1(F)F.
What is the InChIKey of 5-(2,2-difluorooxetan-3-yl)oxy-2-methylpent-1-en-3-one?
The InChIKey is HYCCMJRHIQVILG-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12F2O3/c1-6(2)7(12)3-4-13-8-5-14-9(8,10)11/h8H,1,3-5H2,2H3.
What are the key properties of 5-(2,2-difluorooxetan-3-yl)oxy-2-methylpent-1-en-3-one?
5-(2,2-difluorooxetan-3-yl)oxy-2-methylpent-1-en-3-one has a molecular weight of 206.19 g/mol, XLogP of 1.53, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(2,2-difluorooxetan-3-yl)oxy-2-methylpent-1-en-3-one is sourced from PubChem (CID 118482953), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).