C7H6F4O3 — CID 118482954
1-(2,2,4,4-tetrafluorooxetan-3-yl)oxybut-3-en-2-one (PubChem CID 118482954) has the molecular formula C7H6F4O3 and a molecular weight of 214.11 g/mol. Its IUPAC name is 1-(2,2,4,4-tetrafluorooxetan-3-yl)oxybut-3-en-2-one.
| Compound Name | 1-(2,2,4,4-tetrafluorooxetan-3-yl)oxybut-3-en-2-one |
|---|---|
| PubChem CID | 118482954 |
| Molecular Formula | C7H6F4O3 |
| Molecular Weight | 214.11 g/mol |
| Exact Mass | 214.03 |
| IUPAC Name | 1-(2,2,4,4-tetrafluorooxetan-3-yl)oxybut-3-en-2-one |
| SMILES | C=CC(=O)COC1C(F)(F)OC1(F)F |
| InChI | InChI=1S/C7H6F4O3/c1-2-4(12)3-13-5-6(8,9)14-7(5,10)11/h2,5H,1,3H2 |
| InChIKey | CATWCAYICCLXFD-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.11 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|