C10H11F5O3 — CID 118482993
4-[2-(1,1,2,2,2-pentafluoroethyl)oxetan-3-yl]oxypent-1-en-3-one (PubChem CID 118482993) has the molecular formula C10H11F5O3 and a molecular weight of 274.19 g/mol. Its IUPAC name is 4-[2-(1,1,2,2,2-pentafluoroethyl)oxetan-3-yl]oxypent-1-en-3-one.
| Compound Name | 4-[2-(1,1,2,2,2-pentafluoroethyl)oxetan-3-yl]oxypent-1-en-3-one |
|---|---|
| PubChem CID | 118482993 |
| Molecular Formula | C10H11F5O3 |
| Molecular Weight | 274.19 g/mol |
| Exact Mass | 274.06 |
| IUPAC Name | 4-[2-(1,1,2,2,2-pentafluoroethyl)oxetan-3-yl]oxypent-1-en-3-one |
| SMILES | C=CC(=O)C(C)OC1COC1C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C10H11F5O3/c1-3-6(16)5(2)18-7-4-17-8(7)9(11,12)10(13,14)15/h3,5,7-8H,1,4H2,2H3 |
| InChIKey | MLOVBVIQKRDJAY-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.19 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|