C21H20F8N4O — CID 118483377
[4-[3,4-difluoro-2-(trifluoromethyl)phenyl]piperidin-1-yl]-[5-(3,3,3-trifluoropropyl)-4,6-dihydro-1H-pyrrolo[3,4-d]pyrazol-3-yl]methanone (PubChem CID 118483377) has the molecular formula C21H20F8N4O and a molecular weight of 496.40 g/mol. Its IUPAC name is [4-[3,4-difluoro-2-(trifluoromethyl)phenyl]piperidin-1-yl]-[5-(3,3,3-trifluoropropyl)-4,6-dihydro-1H-pyrrolo[3,4-d]pyrazol-3-yl]methanone.
| Compound Name | [4-[3,4-difluoro-2-(trifluoromethyl)phenyl]piperidin-1-yl]-[5-(3,3,3-trifluoropropyl)-4,6-dihydro-1H-pyrrolo[3,4-d]pyrazol-3-yl]methanone |
|---|---|
| PubChem CID | 118483377 |
| Molecular Formula | C21H20F8N4O |
| Molecular Weight | 496.40 g/mol |
| Exact Mass | 496.15 |
| IUPAC Name | [4-[3,4-difluoro-2-(trifluoromethyl)phenyl]piperidin-1-yl]-[5-(3,3,3-trifluoropropyl)-4,6-dihydro-1H-pyrrolo[3,4-d]pyrazol-3-yl]methanone |
| SMILES | O=C(c1n[nH]c2c1CN(CCC(F)(F)F)C2)N1CCC(c2ccc(F)c(F)c2C(F)(F)F)CC1 |
| InChI | InChI=1S/C21H20F8N4O/c22-14-2-1-12(16(17(14)23)21(27,28)29)11-3-6-33(7-4-11)19(34)18-13-9-32(8-5-20(24,25)26)10-15(13)30-31-18/h1-2,11H,3-10H2,(H,30,31) |
| InChIKey | WCFKZDUVRSHWNK-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 52.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.40 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |