C24H27F5N4O2 — CID 118483401
1-[3-[4-[3,4-difluoro-2-(trifluoromethyl)phenyl]piperidine-1-carbonyl]-1,4,5,7-tetrahydropyrazolo[5,4-c]pyridin-6-yl]-3-methylbutan-1-one (PubChem CID 118483401) has the molecular formula C24H27F5N4O2 and a molecular weight of 498.50 g/mol. Its IUPAC name is 1-[3-[4-[3,4-difluoro-2-(trifluoromethyl)phenyl]piperidine-1-carbonyl]-1,4,5,7-tetrahydropyrazolo[5,4-c]pyridin-6-yl]-3-methylbutan-1-one.
| Compound Name | 1-[3-[4-[3,4-difluoro-2-(trifluoromethyl)phenyl]piperidine-1-carbonyl]-1,4,5,7-tetrahydropyrazolo[5,4-c]pyridin-6-yl]-3-methylbutan-1-one |
|---|---|
| PubChem CID | 118483401 |
| Molecular Formula | C24H27F5N4O2 |
| Molecular Weight | 498.50 g/mol |
| Exact Mass | 498.21 |
| IUPAC Name | 1-[3-[4-[3,4-difluoro-2-(trifluoromethyl)phenyl]piperidine-1-carbonyl]-1,4,5,7-tetrahydropyrazolo[5,4-c]pyridin-6-yl]-3-methylbutan-1-one |
| SMILES | CC(C)CC(=O)N1CCc2c(C(=O)N3CCC(c4ccc(F)c(F)c4C(F)(F)F)CC3)n[nH]c2C1 |
| InChI | InChI=1S/C24H27F5N4O2/c1-13(2)11-19(34)33-10-7-16-18(12-33)30-31-22(16)23(35)32-8-5-14(6-9-32)15-3-4-17(25)21(26)20(15)24(27,28)29/h3-4,13-14H,5-12H2,1-2H3,(H,30,31) |
| InChIKey | OIOXFKNTAAPPQB-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 69.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.50 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |