C21H22F6N4O3S — CID 118483416
[4-[3,5-bis(trifluoromethyl)phenyl]piperidin-1-yl]-(5-methylsulfonyl-1,4,6,7-tetrahydropyrazolo[4,3-c]pyridin-3-yl)methanone (PubChem CID 118483416) has the molecular formula C21H22F6N4O3S and a molecular weight of 524.49 g/mol. Its IUPAC name is [4-[3,5-bis(trifluoromethyl)phenyl]piperidin-1-yl]-(5-methylsulfonyl-1,4,6,7-tetrahydropyrazolo[4,3-c]pyridin-3-yl)methanone.
| Compound Name | [4-[3,5-bis(trifluoromethyl)phenyl]piperidin-1-yl]-(5-methylsulfonyl-1,4,6,7-tetrahydropyrazolo[4,3-c]pyridin-3-yl)methanone |
|---|---|
| PubChem CID | 118483416 |
| Molecular Formula | C21H22F6N4O3S |
| Molecular Weight | 524.49 g/mol |
| Exact Mass | 524.13 |
| IUPAC Name | [4-[3,5-bis(trifluoromethyl)phenyl]piperidin-1-yl]-(5-methylsulfonyl-1,4,6,7-tetrahydropyrazolo[4,3-c]pyridin-3-yl)methanone |
| SMILES | CS(=O)(=O)N1CCc2[nH]nc(C(=O)N3CCC(c4cc(C(F)(F)F)cc(C(F)(F)F)c4)CC3)c2C1 |
| InChI | InChI=1S/C21H22F6N4O3S/c1-35(33,34)31-7-4-17-16(11-31)18(29-28-17)19(32)30-5-2-12(3-6-30)13-8-14(20(22,23)24)10-15(9-13)21(25,26)27/h8-10,12H,2-7,11H2,1H3,(H,28,29) |
| InChIKey | XRKNSSRFHTUUGW-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 86.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.49 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |