C20H18F8N4O — CID 118483462
[4-[3,4-difluoro-2-(trifluoromethyl)phenyl]piperidin-1-yl]-[5-(2,2,2-trifluoroethyl)-4,6-dihydro-1H-pyrrolo[3,4-d]pyrazol-3-yl]methanone (PubChem CID 118483462) has the molecular formula C20H18F8N4O and a molecular weight of 482.38 g/mol. Its IUPAC name is [4-[3,4-difluoro-2-(trifluoromethyl)phenyl]piperidin-1-yl]-[5-(2,2,2-trifluoroethyl)-4,6-dihydro-1H-pyrrolo[3,4-d]pyrazol-3-yl]methanone.
| Compound Name | [4-[3,4-difluoro-2-(trifluoromethyl)phenyl]piperidin-1-yl]-[5-(2,2,2-trifluoroethyl)-4,6-dihydro-1H-pyrrolo[3,4-d]pyrazol-3-yl]methanone |
|---|---|
| PubChem CID | 118483462 |
| Molecular Formula | C20H18F8N4O |
| Molecular Weight | 482.38 g/mol |
| Exact Mass | 482.14 |
| IUPAC Name | [4-[3,4-difluoro-2-(trifluoromethyl)phenyl]piperidin-1-yl]-[5-(2,2,2-trifluoroethyl)-4,6-dihydro-1H-pyrrolo[3,4-d]pyrazol-3-yl]methanone |
| SMILES | O=C(c1n[nH]c2c1CN(CC(F)(F)F)C2)N1CCC(c2ccc(F)c(F)c2C(F)(F)F)CC1 |
| InChI | InChI=1S/C20H18F8N4O/c21-13-2-1-11(15(16(13)22)20(26,27)28)10-3-5-32(6-4-10)18(33)17-12-7-31(9-19(23,24)25)8-14(12)29-30-17/h1-2,10H,3-9H2,(H,29,30) |
| InChIKey | NRFZKVVDOMMYNN-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 52.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.38 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |