C20H20F6N4O — CID 118483485
[4-[3,5-bis(trifluoromethyl)phenyl]piperidin-1-yl]-(4,5,6,7-tetrahydro-1H-pyrazolo[5,4-c]pyridin-3-yl)methanone (PubChem CID 118483485) has the molecular formula C20H20F6N4O and a molecular weight of 446.40 g/mol. Its IUPAC name is [4-[3,5-bis(trifluoromethyl)phenyl]piperidin-1-yl]-(4,5,6,7-tetrahydro-1H-pyrazolo[5,4-c]pyridin-3-yl)methanone.
| Compound Name | [4-[3,5-bis(trifluoromethyl)phenyl]piperidin-1-yl]-(4,5,6,7-tetrahydro-1H-pyrazolo[5,4-c]pyridin-3-yl)methanone |
|---|---|
| PubChem CID | 118483485 |
| Molecular Formula | C20H20F6N4O |
| Molecular Weight | 446.40 g/mol |
| Exact Mass | 446.15 |
| IUPAC Name | [4-[3,5-bis(trifluoromethyl)phenyl]piperidin-1-yl]-(4,5,6,7-tetrahydro-1H-pyrazolo[5,4-c]pyridin-3-yl)methanone |
| SMILES | O=C(c1n[nH]c2c1CCNC2)N1CCC(c2cc(C(F)(F)F)cc(C(F)(F)F)c2)CC1 |
| InChI | InChI=1S/C20H20F6N4O/c21-19(22,23)13-7-12(8-14(9-13)20(24,25)26)11-2-5-30(6-3-11)18(31)17-15-1-4-27-10-16(15)28-29-17/h7-9,11,27H,1-6,10H2,(H,28,29) |
| InChIKey | BXJYBUULIOUKOH-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 61.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.40 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |