C22H22F6N4O2 — CID 118483501
1-[3-[4-[3,5-bis(trifluoromethyl)phenyl]piperidine-1-carbonyl]-1,4,5,7-tetrahydropyrazolo[5,4-c]pyridin-6-yl]ethanone (PubChem CID 118483501) has the molecular formula C22H22F6N4O2 and a molecular weight of 488.43 g/mol. Its IUPAC name is 1-[3-[4-[3,5-bis(trifluoromethyl)phenyl]piperidine-1-carbonyl]-1,4,5,7-tetrahydropyrazolo[5,4-c]pyridin-6-yl]ethanone.
| Compound Name | 1-[3-[4-[3,5-bis(trifluoromethyl)phenyl]piperidine-1-carbonyl]-1,4,5,7-tetrahydropyrazolo[5,4-c]pyridin-6-yl]ethanone |
|---|---|
| PubChem CID | 118483501 |
| Molecular Formula | C22H22F6N4O2 |
| Molecular Weight | 488.43 g/mol |
| Exact Mass | 488.16 |
| IUPAC Name | 1-[3-[4-[3,5-bis(trifluoromethyl)phenyl]piperidine-1-carbonyl]-1,4,5,7-tetrahydropyrazolo[5,4-c]pyridin-6-yl]ethanone |
| SMILES | CC(=O)N1CCc2c(C(=O)N3CCC(c4cc(C(F)(F)F)cc(C(F)(F)F)c4)CC3)n[nH]c2C1 |
| InChI | InChI=1S/C22H22F6N4O2/c1-12(33)32-7-4-17-18(11-32)29-30-19(17)20(34)31-5-2-13(3-6-31)14-8-15(21(23,24)25)10-16(9-14)22(26,27)28/h8-10,13H,2-7,11H2,1H3,(H,29,30) |
| InChIKey | UYJQGBUMNGFPIF-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 69.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.43 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |