About cis-(1S,2S)-1,2-diphenylcyclopropan-1-amine;hydrochloride
cis-(1S,2S)-1,2-diphenylcyclopropan-1-amine;hydrochloride (PubChem CID 118483914) has the molecular formula C15H16ClN
and a molecular weight of 245.75 g/mol. Its IUPAC name is cis-(1S,2S)-1,2-diphenylcyclopropan-1-amine;hydrochloride.
Molecular Properties
| Compound Name | cis-(1S,2S)-1,2-diphenylcyclopropan-1-amine;hydrochloride |
| PubChem CID | 118483914 |
| Molecular Formula | C15H16ClN |
| Molecular Weight | 245.75 g/mol |
| Exact Mass | 245.10 |
| IUPAC Name | cis-(1S,2S)-1,2-diphenylcyclopropan-1-amine;hydrochloride |
| SMILES | Cl.N[C@@]1(c2ccccc2)C[C@H]1c1ccccc1 |
| InChI | InChI=1S/C15H15N.ClH/c16-15(13-9-5-2-6-10-13)11-14(15)12-7-3-1-4-8-12;/h1-10,14H,11,16H2;1H/t14-,15+;/m0./s1 |
| InChIKey | YZRAPGMDGOUWPD-LDXVYITESA-N |
| XLogP | 3.45 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.75 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze cis-(1S,2S)-1,2-diphenylcyclopropan-1-amine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cis-(1S,2S)-1,2-diphenylcyclopropan-1-amine;hydrochloride?
The IUPAC name of cis-(1S,2S)-1,2-diphenylcyclopropan-1-amine;hydrochloride (CID 118483914) is cis-(1S,2S)-1,2-diphenylcyclopropan-1-amine;hydrochloride.
What is the SMILES notation for cis-(1S,2S)-1,2-diphenylcyclopropan-1-amine;hydrochloride?
The canonical SMILES for cis-(1S,2S)-1,2-diphenylcyclopropan-1-amine;hydrochloride is Cl.N[C@@]1(c2ccccc2)C[C@H]1c1ccccc1.
What is the InChIKey of cis-(1S,2S)-1,2-diphenylcyclopropan-1-amine;hydrochloride?
The InChIKey is YZRAPGMDGOUWPD-LDXVYITESA-N. The full InChI is InChI=1S/C15H15N.ClH/c16-15(13-9-5-2-6-10-13)11-14(15)12-7-3-1-4-8-12;/h1-10,14H,11,16H2;1H/t14-,15+;/m0./s1.
What are the key properties of cis-(1S,2S)-1,2-diphenylcyclopropan-1-amine;hydrochloride?
cis-(1S,2S)-1,2-diphenylcyclopropan-1-amine;hydrochloride has a molecular weight of 245.75 g/mol, XLogP of 3.45, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for cis-(1S,2S)-1,2-diphenylcyclopropan-1-amine;hydrochloride is sourced from PubChem (CID 118483914), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).