C19H23ClN6 — CID 118483962
13-ethyl-2,3,11,15-tetrazatricyclo[15.4.0.04,9]henicosa-1(21),2,4,6,8,11,14,17,19-nonaene-12,14-diamine;hydrochloride (PubChem CID 118483962) has the molecular formula C19H23ClN6 and a molecular weight of 370.89 g/mol. Its IUPAC name is 13-ethyl-2,3,11,15-tetrazatricyclo[15.4.0.04,9]henicosa-1(21),2,4,6,8,11,14,17,19-nonaene-12,14-diamine;hydrochloride.
| Compound Name | 13-ethyl-2,3,11,15-tetrazatricyclo[15.4.0.04,9]henicosa-1(21),2,4,6,8,11,14,17,19-nonaene-12,14-diamine;hydrochloride |
|---|---|
| PubChem CID | 118483962 |
| Molecular Formula | C19H23ClN6 |
| Molecular Weight | 370.89 g/mol |
| Exact Mass | 370.17 |
| IUPAC Name | 13-ethyl-2,3,11,15-tetrazatricyclo[15.4.0.04,9]henicosa-1(21),2,4,6,8,11,14,17,19-nonaene-12,14-diamine;hydrochloride |
| SMILES | CCC1/C(N)=N/Cc2ccccc2/N=N/c2ccccc2C/N=C\1N.Cl |
| InChI | InChI=1S/C19H22N6.ClH/c1-2-15-18(20)22-11-13-7-3-5-9-16(13)24-25-17-10-6-4-8-14(17)12-23-19(15)21;/h3-10,15H,2,11-12H2,1H3,(H2,20,22)(H2,21,23);1H/b25-24+; |
| InChIKey | KGWSLTBRIVEAHU-QREUMGABSA-N |
| XLogP | 4.28 |
| TPSA | 101.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.89 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |