C24H35N7O — CID 118484088
5-[[2-methoxy-4-(piperazin-1-ylmethyl)phenyl]methyl]-4-N-pentylpyrrolo[3,2-d]pyrimidine-2,4-diamine (PubChem CID 118484088) has the molecular formula C24H35N7O and a molecular weight of 437.59 g/mol. Its IUPAC name is 5-[[2-methoxy-4-(piperazin-1-ylmethyl)phenyl]methyl]-4-N-pentylpyrrolo[3,2-d]pyrimidine-2,4-diamine.
| Compound Name | 5-[[2-methoxy-4-(piperazin-1-ylmethyl)phenyl]methyl]-4-N-pentylpyrrolo[3,2-d]pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 118484088 |
| Molecular Formula | C24H35N7O |
| Molecular Weight | 437.59 g/mol |
| Exact Mass | 437.29 |
| IUPAC Name | 5-[[2-methoxy-4-(piperazin-1-ylmethyl)phenyl]methyl]-4-N-pentylpyrrolo[3,2-d]pyrimidine-2,4-diamine |
| SMILES | CCCCCNc1nc(N)nc2ccn(Cc3ccc(CN4CCNCC4)cc3OC)c12 |
| InChI | InChI=1S/C24H35N7O/c1-3-4-5-9-27-23-22-20(28-24(25)29-23)8-12-31(22)17-19-7-6-18(15-21(19)32-2)16-30-13-10-26-11-14-30/h6-8,12,15,26H,3-5,9-11,13-14,16-17H2,1-2H3,(H3,25,27,28,29) |
| InChIKey | LMXTZUAHGZBEKB-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 93.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.59 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|