C24H33N5O3 — CID 118484091
ethyl 3-[3-[[2-amino-4-(pentylamino)pyrrolo[3,2-d]pyrimidin-5-yl]methyl]-4-methoxyphenyl]propanoate (PubChem CID 118484091) has the molecular formula C24H33N5O3 and a molecular weight of 439.56 g/mol. Its IUPAC name is ethyl 3-[3-[[2-amino-4-(pentylamino)pyrrolo[3,2-d]pyrimidin-5-yl]methyl]-4-methoxyphenyl]propanoate.
| Compound Name | ethyl 3-[3-[[2-amino-4-(pentylamino)pyrrolo[3,2-d]pyrimidin-5-yl]methyl]-4-methoxyphenyl]propanoate |
|---|---|
| PubChem CID | 118484091 |
| Molecular Formula | C24H33N5O3 |
| Molecular Weight | 439.56 g/mol |
| Exact Mass | 439.26 |
| IUPAC Name | ethyl 3-[3-[[2-amino-4-(pentylamino)pyrrolo[3,2-d]pyrimidin-5-yl]methyl]-4-methoxyphenyl]propanoate |
| SMILES | CCCCCNc1nc(N)nc2ccn(Cc3cc(CCC(=O)OCC)ccc3OC)c12 |
| InChI | InChI=1S/C24H33N5O3/c1-4-6-7-13-26-23-22-19(27-24(25)28-23)12-14-29(22)16-18-15-17(8-10-20(18)31-3)9-11-21(30)32-5-2/h8,10,12,14-15H,4-7,9,11,13,16H2,1-3H3,(H3,25,26,27,28) |
| InChIKey | CGJMKTBLNLYJHB-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 104.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.56 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|