C22H27F2N5O3 — CID 118484103
methyl 2-[3-[[2-amino-4-(pentylamino)pyrrolo[3,2-d]pyrimidin-5-yl]methyl]-4-methoxyphenyl]-2,2-difluoroacetate (PubChem CID 118484103) has the molecular formula C22H27F2N5O3 and a molecular weight of 447.49 g/mol. Its IUPAC name is methyl 2-[3-[[2-amino-4-(pentylamino)pyrrolo[3,2-d]pyrimidin-5-yl]methyl]-4-methoxyphenyl]-2,2-difluoroacetate.
| Compound Name | methyl 2-[3-[[2-amino-4-(pentylamino)pyrrolo[3,2-d]pyrimidin-5-yl]methyl]-4-methoxyphenyl]-2,2-difluoroacetate |
|---|---|
| PubChem CID | 118484103 |
| Molecular Formula | C22H27F2N5O3 |
| Molecular Weight | 447.49 g/mol |
| Exact Mass | 447.21 |
| IUPAC Name | methyl 2-[3-[[2-amino-4-(pentylamino)pyrrolo[3,2-d]pyrimidin-5-yl]methyl]-4-methoxyphenyl]-2,2-difluoroacetate |
| SMILES | CCCCCNc1nc(N)nc2ccn(Cc3cc(C(F)(F)C(=O)OC)ccc3OC)c12 |
| InChI | InChI=1S/C22H27F2N5O3/c1-4-5-6-10-26-19-18-16(27-21(25)28-19)9-11-29(18)13-14-12-15(7-8-17(14)31-2)22(23,24)20(30)32-3/h7-9,11-12H,4-6,10,13H2,1-3H3,(H3,25,26,27,28) |
| InChIKey | DWUQECPGRFUAPF-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 104.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.49 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|