About [(3S,6E)-6-(cyanomethylidene)oxan-3-yl]carbamic acid
[(3S,6E)-6-(cyanomethylidene)oxan-3-yl]carbamic acid (PubChem CID 118484489) has the molecular formula C8H10N2O3
and a molecular weight of 182.18 g/mol. Its IUPAC name is [(3S,6E)-6-(cyanomethylidene)oxan-3-yl]carbamic acid.
Molecular Properties
| Compound Name | [(3S,6E)-6-(cyanomethylidene)oxan-3-yl]carbamic acid |
| PubChem CID | 118484489 |
| Molecular Formula | C8H10N2O3 |
| Molecular Weight | 182.18 g/mol |
| Exact Mass | 182.07 |
| IUPAC Name | [(3S,6E)-6-(cyanomethylidene)oxan-3-yl]carbamic acid |
| SMILES | N#C/C=C1\CC[C@H](NC(=O)O)CO1 |
| InChI | InChI=1S/C8H10N2O3/c9-4-3-7-2-1-6(5-13-7)10-8(11)12/h3,6,10H,1-2,5H2,(H,11,12)/b7-3+/t6-/m0/s1 |
| InChIKey | OUBPUBPIRLKLJI-CFYVXFRNSA-N |
| XLogP | 0.84 |
| TPSA | 82.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.18 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|
Analyze [(3S,6E)-6-(cyanomethylidene)oxan-3-yl]carbamic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(3S,6E)-6-(cyanomethylidene)oxan-3-yl]carbamic acid?
The IUPAC name of [(3S,6E)-6-(cyanomethylidene)oxan-3-yl]carbamic acid (CID 118484489) is [(3S,6E)-6-(cyanomethylidene)oxan-3-yl]carbamic acid.
What is the SMILES notation for [(3S,6E)-6-(cyanomethylidene)oxan-3-yl]carbamic acid?
The canonical SMILES for [(3S,6E)-6-(cyanomethylidene)oxan-3-yl]carbamic acid is N#C/C=C1\CC[C@H](NC(=O)O)CO1.
What is the InChIKey of [(3S,6E)-6-(cyanomethylidene)oxan-3-yl]carbamic acid?
The InChIKey is OUBPUBPIRLKLJI-CFYVXFRNSA-N. The full InChI is InChI=1S/C8H10N2O3/c9-4-3-7-2-1-6(5-13-7)10-8(11)12/h3,6,10H,1-2,5H2,(H,11,12)/b7-3+/t6-/m0/s1.
What are the key properties of [(3S,6E)-6-(cyanomethylidene)oxan-3-yl]carbamic acid?
[(3S,6E)-6-(cyanomethylidene)oxan-3-yl]carbamic acid has a molecular weight of 182.18 g/mol, XLogP of 0.84, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(3S,6E)-6-(cyanomethylidene)oxan-3-yl]carbamic acid is sourced from PubChem (CID 118484489), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).