About [(3R,6R)-6-(cyanomethyl)oxan-3-yl]carbamic acid
[(3R,6R)-6-(cyanomethyl)oxan-3-yl]carbamic acid (PubChem CID 118484501) has the molecular formula C8H12N2O3
and a molecular weight of 184.19 g/mol. Its IUPAC name is [(3R,6R)-6-(cyanomethyl)oxan-3-yl]carbamic acid.
Molecular Properties
| Compound Name | [(3R,6R)-6-(cyanomethyl)oxan-3-yl]carbamic acid |
| PubChem CID | 118484501 |
| Molecular Formula | C8H12N2O3 |
| Molecular Weight | 184.19 g/mol |
| Exact Mass | 184.08 |
| IUPAC Name | [(3R,6R)-6-(cyanomethyl)oxan-3-yl]carbamic acid |
| SMILES | N#CC[C@H]1CC[C@@H](NC(=O)O)CO1 |
| InChI | InChI=1S/C8H12N2O3/c9-4-3-7-2-1-6(5-13-7)10-8(11)12/h6-7,10H,1-3,5H2,(H,11,12)/t6-,7-/m1/s1 |
| InChIKey | SQAXAKARQZOULR-RNFRBKRXSA-N |
| XLogP | 0.72 |
| TPSA | 82.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.19 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [(3R,6R)-6-(cyanomethyl)oxan-3-yl]carbamic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(3R,6R)-6-(cyanomethyl)oxan-3-yl]carbamic acid?
The IUPAC name of [(3R,6R)-6-(cyanomethyl)oxan-3-yl]carbamic acid (CID 118484501) is [(3R,6R)-6-(cyanomethyl)oxan-3-yl]carbamic acid.
What is the SMILES notation for [(3R,6R)-6-(cyanomethyl)oxan-3-yl]carbamic acid?
The canonical SMILES for [(3R,6R)-6-(cyanomethyl)oxan-3-yl]carbamic acid is N#CC[C@H]1CC[C@@H](NC(=O)O)CO1.
What is the InChIKey of [(3R,6R)-6-(cyanomethyl)oxan-3-yl]carbamic acid?
The InChIKey is SQAXAKARQZOULR-RNFRBKRXSA-N. The full InChI is InChI=1S/C8H12N2O3/c9-4-3-7-2-1-6(5-13-7)10-8(11)12/h6-7,10H,1-3,5H2,(H,11,12)/t6-,7-/m1/s1.
What are the key properties of [(3R,6R)-6-(cyanomethyl)oxan-3-yl]carbamic acid?
[(3R,6R)-6-(cyanomethyl)oxan-3-yl]carbamic acid has a molecular weight of 184.19 g/mol, XLogP of 0.72, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(3R,6R)-6-(cyanomethyl)oxan-3-yl]carbamic acid is sourced from PubChem (CID 118484501), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).