C8H7F5N2O2 — CID 118484811
4,6-dimethoxy-5-(1,1,2,2,2-pentafluoroethyl)pyrimidine (PubChem CID 118484811) has the molecular formula C8H7F5N2O2 and a molecular weight of 258.15 g/mol. Its IUPAC name is 4,6-dimethoxy-5-(1,1,2,2,2-pentafluoroethyl)pyrimidine.
| Compound Name | 4,6-dimethoxy-5-(1,1,2,2,2-pentafluoroethyl)pyrimidine |
|---|---|
| PubChem CID | 118484811 |
| Molecular Formula | C8H7F5N2O2 |
| Molecular Weight | 258.15 g/mol |
| Exact Mass | 258.04 |
| IUPAC Name | 4,6-dimethoxy-5-(1,1,2,2,2-pentafluoroethyl)pyrimidine |
| SMILES | COc1ncnc(OC)c1C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C8H7F5N2O2/c1-16-5-4(6(17-2)15-3-14-5)7(9,10)8(11,12)13/h3H,1-2H3 |
| InChIKey | ANAQYZHLZXVVHO-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.15 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|