C16H14F4N4O2 — CID 118484974
N-(5-fluoro-6-morpholin-2-yl-3-pyridinyl)-2-(trifluoromethyl)pyridine-4-carboxamide (PubChem CID 118484974) has the molecular formula C16H14F4N4O2 and a molecular weight of 370.31 g/mol. Its IUPAC name is N-(5-fluoro-6-morpholin-2-yl-3-pyridinyl)-2-(trifluoromethyl)pyridine-4-carboxamide.
| Compound Name | N-(5-fluoro-6-morpholin-2-yl-3-pyridinyl)-2-(trifluoromethyl)pyridine-4-carboxamide |
|---|---|
| PubChem CID | 118484974 |
| Molecular Formula | C16H14F4N4O2 |
| Molecular Weight | 370.31 g/mol |
| Exact Mass | 370.11 |
| IUPAC Name | N-(5-fluoro-6-morpholin-2-yl-3-pyridinyl)-2-(trifluoromethyl)pyridine-4-carboxamide |
| SMILES | O=C(Nc1cnc(C2CNCCO2)c(F)c1)c1ccnc(C(F)(F)F)c1 |
| InChI | InChI=1S/C16H14F4N4O2/c17-11-6-10(7-23-14(11)12-8-21-3-4-26-12)24-15(25)9-1-2-22-13(5-9)16(18,19)20/h1-2,5-7,12,21H,3-4,8H2,(H,24,25) |
| InChIKey | JUXVIIGAZNJVPR-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 76.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.31 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |