C17H23N5O2 — CID 118485072
5-butyl-N-[6-[(2R)-morpholin-2-yl]-3-pyridinyl]-1H-pyrazole-3-carboxamide (PubChem CID 118485072) has the molecular formula C17H23N5O2 and a molecular weight of 329.40 g/mol. Its IUPAC name is 5-butyl-N-[6-[(2R)-morpholin-2-yl]-3-pyridinyl]-1H-pyrazole-3-carboxamide.
| Compound Name | 5-butyl-N-[6-[(2R)-morpholin-2-yl]-3-pyridinyl]-1H-pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 118485072 |
| Molecular Formula | C17H23N5O2 |
| Molecular Weight | 329.40 g/mol |
| Exact Mass | 329.19 |
| IUPAC Name | 5-butyl-N-[6-[(2R)-morpholin-2-yl]-3-pyridinyl]-1H-pyrazole-3-carboxamide |
| SMILES | CCCCc1cc(C(=O)Nc2ccc([C@H]3CNCCO3)nc2)n[nH]1 |
| InChI | InChI=1S/C17H23N5O2/c1-2-3-4-12-9-15(22-21-12)17(23)20-13-5-6-14(19-10-13)16-11-18-7-8-24-16/h5-6,9-10,16,18H,2-4,7-8,11H2,1H3,(H,20,23)(H,21,22)/t16-/m1/s1 |
| InChIKey | RNLSRHLFNAVXAU-MRXNPFEDSA-N |
| XLogP | 2.06 |
| TPSA | 91.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.40 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |