About 3-phosphanylbenzene-1,2-dithiol
3-phosphanylbenzene-1,2-dithiol (PubChem CID 118486271) has the molecular formula C6H7PS2
and a molecular weight of 174.23 g/mol. Its IUPAC name is 3-phosphanylbenzene-1,2-dithiol.
Molecular Properties
| Compound Name | 3-phosphanylbenzene-1,2-dithiol |
| PubChem CID | 118486271 |
| Molecular Formula | C6H7PS2 |
| Molecular Weight | 174.23 g/mol |
| Exact Mass | 173.97 |
| IUPAC Name | 3-phosphanylbenzene-1,2-dithiol |
| SMILES | Pc1cccc(S)c1S |
| InChI | InChI=1S/C6H7PS2/c7-4-2-1-3-5(8)6(4)9/h1-3,8-9H,7H2 |
| InChIKey | ZMWYSELEYGHCBF-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.23 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 3-phosphanylbenzene-1,2-dithiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-phosphanylbenzene-1,2-dithiol?
The IUPAC name of 3-phosphanylbenzene-1,2-dithiol (CID 118486271) is 3-phosphanylbenzene-1,2-dithiol.
What is the SMILES notation for 3-phosphanylbenzene-1,2-dithiol?
The canonical SMILES for 3-phosphanylbenzene-1,2-dithiol is Pc1cccc(S)c1S.
What is the InChIKey of 3-phosphanylbenzene-1,2-dithiol?
The InChIKey is ZMWYSELEYGHCBF-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H7PS2/c7-4-2-1-3-5(8)6(4)9/h1-3,8-9H,7H2.
What are the key properties of 3-phosphanylbenzene-1,2-dithiol?
3-phosphanylbenzene-1,2-dithiol has a molecular weight of 174.23 g/mol, XLogP of 1.76, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-phosphanylbenzene-1,2-dithiol is sourced from PubChem (CID 118486271), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).