C16H11N3O — CID 118486408
3-phenyl-5-(1H-pyrazol-4-yl)furo[3,2-b]pyridine (PubChem CID 118486408) has the molecular formula C16H11N3O and a molecular weight of 261.28 g/mol. Its IUPAC name is 3-phenyl-5-(1H-pyrazol-4-yl)furo[3,2-b]pyridine.
| Compound Name | 3-phenyl-5-(1H-pyrazol-4-yl)furo[3,2-b]pyridine |
|---|---|
| PubChem CID | 118486408 |
| Molecular Formula | C16H11N3O |
| Molecular Weight | 261.28 g/mol |
| Exact Mass | 261.09 |
| IUPAC Name | 3-phenyl-5-(1H-pyrazol-4-yl)furo[3,2-b]pyridine |
| SMILES | c1ccc(-c2coc3ccc(-c4cn[nH]c4)nc23)cc1 |
| InChI | InChI=1S/C16H11N3O/c1-2-4-11(5-3-1)13-10-20-15-7-6-14(19-16(13)15)12-8-17-18-9-12/h1-10H,(H,17,18) |
| InChIKey | YJVHRHNVCYWWCM-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 54.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.28 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |