C21H20F3N3O4 — CID 118486546
2-[2-[4-[4-amino-3-(trifluoromethoxy)phenoxy]phenyl]ethoxy]-5-ethyl-1H-pyrimidin-6-one (PubChem CID 118486546) has the molecular formula C21H20F3N3O4 and a molecular weight of 435.40 g/mol. Its IUPAC name is 2-[2-[4-[4-amino-3-(trifluoromethoxy)phenoxy]phenyl]ethoxy]-5-ethyl-1H-pyrimidin-6-one.
| Compound Name | 2-[2-[4-[4-amino-3-(trifluoromethoxy)phenoxy]phenyl]ethoxy]-5-ethyl-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 118486546 |
| Molecular Formula | C21H20F3N3O4 |
| Molecular Weight | 435.40 g/mol |
| Exact Mass | 435.14 |
| IUPAC Name | 2-[2-[4-[4-amino-3-(trifluoromethoxy)phenoxy]phenyl]ethoxy]-5-ethyl-1H-pyrimidin-6-one |
| SMILES | CCc1cnc(OCCc2ccc(Oc3ccc(N)c(OC(F)(F)F)c3)cc2)[nH]c1=O |
| InChI | InChI=1S/C21H20F3N3O4/c1-2-14-12-26-20(27-19(14)28)29-10-9-13-3-5-15(6-4-13)30-16-7-8-17(25)18(11-16)31-21(22,23)24/h3-8,11-12H,2,9-10,25H2,1H3,(H,26,27,28) |
| InChIKey | CMLBZKLPSGNPCZ-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 99.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.40 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|