C11H18N5O6P — CID 118486581
9-[(7aR)-2-hydroxy-7-methoxy-2-oxo-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3,2]dioxaphosphinin-6-yl]-3,6,7,8-tetrahydropurin-6-amine (PubChem CID 118486581) has the molecular formula C11H18N5O6P and a molecular weight of 347.27 g/mol. Its IUPAC name is 9-[(7aR)-2-hydroxy-7-methoxy-2-oxo-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3,2]dioxaphosphinin-6-yl]-3,6,7,8-tetrahydropurin-6-amine.
| Compound Name | 9-[(7aR)-2-hydroxy-7-methoxy-2-oxo-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3,2]dioxaphosphinin-6-yl]-3,6,7,8-tetrahydropurin-6-amine |
|---|---|
| PubChem CID | 118486581 |
| Molecular Formula | C11H18N5O6P |
| Molecular Weight | 347.27 g/mol |
| Exact Mass | 347.10 |
| IUPAC Name | 9-[(7aR)-2-hydroxy-7-methoxy-2-oxo-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3,2]dioxaphosphinin-6-yl]-3,6,7,8-tetrahydropurin-6-amine |
| SMILES | COC1C(N2CNC3=C2NC=NC3N)OC2COP(=O)(O)O[C@H]21 |
| InChI | InChI=1S/C11H18N5O6P/c1-19-8-7-5(2-20-23(17,18)22-7)21-11(8)16-4-15-6-9(12)13-3-14-10(6)16/h3,5,7-9,11,15H,2,4,12H2,1H3,(H,13,14)(H,17,18)/t5?,7-,8?,9?,11?/m1/s1 |
| InChIKey | ZAPUDXQSDIFODJ-NYMDIBFYSA-N |
| XLogP | -1.81 |
| TPSA | 139.90 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.27 |
| LogP ≤ 5 | -1.81 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|