C12H23N5O7P+ — CID 118486618
9-[(4aR,7aR)-2,2-dihydroxy-7-methoxy-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3,2]dioxaphosphinin-2-ium-6-yl]-8-methoxy-1,2,3,6,7,8-hexahydropurin-6-amine (PubChem CID 118486618) has the molecular formula C12H23N5O7P+ and a molecular weight of 380.32 g/mol. Its IUPAC name is 9-[(4aR,7aR)-2,2-dihydroxy-7-methoxy-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3,2]dioxaphosphinin-2-ium-6-yl]-8-methoxy-1,2,3,6,7,8-hexahydropurin-6-amine.
| Compound Name | 9-[(4aR,7aR)-2,2-dihydroxy-7-methoxy-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3,2]dioxaphosphinin-2-ium-6-yl]-8-methoxy-1,2,3,6,7,8-hexahydropurin-6-amine |
|---|---|
| PubChem CID | 118486618 |
| Molecular Formula | C12H23N5O7P+ |
| Molecular Weight | 380.32 g/mol |
| Exact Mass | 380.13 |
| IUPAC Name | 9-[(4aR,7aR)-2,2-dihydroxy-7-methoxy-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3,2]dioxaphosphinin-2-ium-6-yl]-8-methoxy-1,2,3,6,7,8-hexahydropurin-6-amine |
| SMILES | COC1C(N2C3=C(NC2OC)C(N)NCN3)O[C@@H]2CO[P+](O)(O)O[C@@H]12 |
| InChI | InChI=1S/C12H23N5O7P/c1-20-8-7-5(3-22-25(18,19)24-7)23-11(8)17-10-6(16-12(17)21-2)9(13)14-4-15-10/h5,7-9,11-12,14-16,18-19H,3-4,13H2,1-2H3/q+1/t5-,7-,8?,9?,11?,12?/m1/s1 |
| InChIKey | IECSFUOMWDLCFZ-YPYYWGTJSA-N |
| XLogP | -2.76 |
| TPSA | 151.96 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.32 |
| LogP ≤ 5 | -2.76 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|