C11H18ClN5O6P+ — CID 118486622
9-[(7aR)-2,2-dihydroxy-7-methoxy-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3,2]dioxaphosphinin-2-ium-6-yl]-8-chloro-3,6,7,8-tetrahydropurin-6-amine (PubChem CID 118486622) has the molecular formula C11H18ClN5O6P+ and a molecular weight of 382.72 g/mol. Its IUPAC name is 9-[(7aR)-2,2-dihydroxy-7-methoxy-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3,2]dioxaphosphinin-2-ium-6-yl]-8-chloro-3,6,7,8-tetrahydropurin-6-amine.
| Compound Name | 9-[(7aR)-2,2-dihydroxy-7-methoxy-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3,2]dioxaphosphinin-2-ium-6-yl]-8-chloro-3,6,7,8-tetrahydropurin-6-amine |
|---|---|
| PubChem CID | 118486622 |
| Molecular Formula | C11H18ClN5O6P+ |
| Molecular Weight | 382.72 g/mol |
| Exact Mass | 382.07 |
| IUPAC Name | 9-[(7aR)-2,2-dihydroxy-7-methoxy-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3,2]dioxaphosphinin-2-ium-6-yl]-8-chloro-3,6,7,8-tetrahydropurin-6-amine |
| SMILES | COC1C(N2C3=C(NC2Cl)C(N)N=CN3)OC2CO[P+](O)(O)O[C@H]21 |
| InChI | InChI=1S/C11H18ClN5O6P/c1-20-7-6-4(2-21-24(18,19)23-6)22-10(7)17-9-5(16-11(17)12)8(13)14-3-15-9/h3-4,6-8,10-11,16,18-19H,2,13H2,1H3,(H,14,15)/q+1/t4?,6-,7?,8?,10?,11?/m1/s1 |
| InChIKey | QCBABNZKEYUGSA-VFZLTDGKSA-N |
| XLogP | -1.68 |
| TPSA | 143.06 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.72 |
| LogP ≤ 5 | -1.68 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|