C29H40FNO4 — CID 118486746
ethyl 5-[2-[(1R)-1-[(2R)-3-[2-[(3-fluoro-4-methylphenyl)methyl]azetidin-1-yl]-2-hydroxypropoxy]ethyl]phenyl]pentanoate (PubChem CID 118486746) has the molecular formula C29H40FNO4 and a molecular weight of 485.64 g/mol. Its IUPAC name is ethyl 5-[2-[(1R)-1-[(2R)-3-[2-[(3-fluoro-4-methylphenyl)methyl]azetidin-1-yl]-2-hydroxypropoxy]ethyl]phenyl]pentanoate.
| Compound Name | ethyl 5-[2-[(1R)-1-[(2R)-3-[2-[(3-fluoro-4-methylphenyl)methyl]azetidin-1-yl]-2-hydroxypropoxy]ethyl]phenyl]pentanoate |
|---|---|
| PubChem CID | 118486746 |
| Molecular Formula | C29H40FNO4 |
| Molecular Weight | 485.64 g/mol |
| Exact Mass | 485.29 |
| IUPAC Name | ethyl 5-[2-[(1R)-1-[(2R)-3-[2-[(3-fluoro-4-methylphenyl)methyl]azetidin-1-yl]-2-hydroxypropoxy]ethyl]phenyl]pentanoate |
| SMILES | CCOC(=O)CCCCc1ccccc1[C@@H](C)OC[C@H](O)CN1CCC1Cc1ccc(C)c(F)c1 |
| InChI | InChI=1S/C29H40FNO4/c1-4-34-29(33)12-8-6-10-24-9-5-7-11-27(24)22(3)35-20-26(32)19-31-16-15-25(31)17-23-14-13-21(2)28(30)18-23/h5,7,9,11,13-14,18,22,25-26,32H,4,6,8,10,12,15-17,19-20H2,1-3H3/t22-,25?,26-/m1/s1 |
| InChIKey | JWMHZLSOYRCWKP-ROJAKFQKSA-N |
| XLogP | 5.17 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.64 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|