About (6-methyl-1,2-dihydropyridin-4-yl)methanimine
(6-methyl-1,2-dihydropyridin-4-yl)methanimine (PubChem CID 118486764) has the molecular formula C7H10N2
and a molecular weight of 122.17 g/mol. Its IUPAC name is (6-methyl-1,2-dihydropyridin-4-yl)methanimine.
Molecular Properties
| Compound Name | (6-methyl-1,2-dihydropyridin-4-yl)methanimine |
| PubChem CID | 118486764 |
| Molecular Formula | C7H10N2 |
| Molecular Weight | 122.17 g/mol |
| Exact Mass | 122.08 |
| IUPAC Name | (6-methyl-1,2-dihydropyridin-4-yl)methanimine |
| SMILES | [H]/N=C/C1=CCNC(C)=C1 |
| InChI | InChI=1S/C7H10N2/c1-6-4-7(5-8)2-3-9-6/h2,4-5,8-9H,3H2,1H3/b8-5+ |
| InChIKey | JMDURNVRZIJMFW-VMPITWQZSA-N |
| XLogP | 1.07 |
| TPSA | 35.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 122.17 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze (6-methyl-1,2-dihydropyridin-4-yl)methanimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6-methyl-1,2-dihydropyridin-4-yl)methanimine?
The IUPAC name of (6-methyl-1,2-dihydropyridin-4-yl)methanimine (CID 118486764) is (6-methyl-1,2-dihydropyridin-4-yl)methanimine.
What is the SMILES notation for (6-methyl-1,2-dihydropyridin-4-yl)methanimine?
The canonical SMILES for (6-methyl-1,2-dihydropyridin-4-yl)methanimine is [H]/N=C/C1=CCNC(C)=C1.
What is the InChIKey of (6-methyl-1,2-dihydropyridin-4-yl)methanimine?
The InChIKey is JMDURNVRZIJMFW-VMPITWQZSA-N. The full InChI is InChI=1S/C7H10N2/c1-6-4-7(5-8)2-3-9-6/h2,4-5,8-9H,3H2,1H3/b8-5+.
What are the key properties of (6-methyl-1,2-dihydropyridin-4-yl)methanimine?
(6-methyl-1,2-dihydropyridin-4-yl)methanimine has a molecular weight of 122.17 g/mol, XLogP of 1.07, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (6-methyl-1,2-dihydropyridin-4-yl)methanimine is sourced from PubChem (CID 118486764), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).