C19H28N4O — CID 118487213
(1Z,5Z)-4,7-diamino-5-(cyclohexa-2,4-dien-1-ylamino)-1-(cyclohex-2-en-1-ylamino)hepta-1,5-dien-3-one (PubChem CID 118487213) has the molecular formula C19H28N4O and a molecular weight of 328.46 g/mol. Its IUPAC name is (1Z,5Z)-4,7-diamino-5-(cyclohexa-2,4-dien-1-ylamino)-1-(cyclohex-2-en-1-ylamino)hepta-1,5-dien-3-one.
| Compound Name | (1Z,5Z)-4,7-diamino-5-(cyclohexa-2,4-dien-1-ylamino)-1-(cyclohex-2-en-1-ylamino)hepta-1,5-dien-3-one |
|---|---|
| PubChem CID | 118487213 |
| Molecular Formula | C19H28N4O |
| Molecular Weight | 328.46 g/mol |
| Exact Mass | 328.23 |
| IUPAC Name | (1Z,5Z)-4,7-diamino-5-(cyclohexa-2,4-dien-1-ylamino)-1-(cyclohex-2-en-1-ylamino)hepta-1,5-dien-3-one |
| SMILES | NC/C=C(\NC1C=CC=CC1)C(N)C(=O)/C=C\NC1C=CCCC1 |
| InChI | InChI=1S/C19H28N4O/c20-13-11-17(23-16-9-5-2-6-10-16)19(21)18(24)12-14-22-15-7-3-1-4-8-15/h2-3,5-7,9,11-12,14-16,19,22-23H,1,4,8,10,13,20-21H2/b14-12-,17-11- |
| InChIKey | HFKSCPHXVAIYKZ-JEVNUMMASA-N |
| XLogP | 1.41 |
| TPSA | 93.17 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.46 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|