C8H9F4N — CID 118487358
(2Z,4E)-6-fluoro-5-(trifluoromethyl)hepta-2,4,6-trien-1-amine (PubChem CID 118487358) has the molecular formula C8H9F4N and a molecular weight of 195.16 g/mol. Its IUPAC name is (2Z,4E)-6-fluoro-5-(trifluoromethyl)hepta-2,4,6-trien-1-amine.
| Compound Name | (2Z,4E)-6-fluoro-5-(trifluoromethyl)hepta-2,4,6-trien-1-amine |
|---|---|
| PubChem CID | 118487358 |
| Molecular Formula | C8H9F4N |
| Molecular Weight | 195.16 g/mol |
| Exact Mass | 195.07 |
| IUPAC Name | (2Z,4E)-6-fluoro-5-(trifluoromethyl)hepta-2,4,6-trien-1-amine |
| SMILES | C=C(F)/C(=C\C=C/CN)C(F)(F)F |
| InChI | InChI=1S/C8H9F4N/c1-6(9)7(8(10,11)12)4-2-3-5-13/h2-4H,1,5,13H2/b3-2-,7-4+ |
| InChIKey | NQHADNBXSWADHJ-UDJLOATDSA-N |
| XLogP | 2.47 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.16 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|