About 2,2-difluoro-5H-cyclopenta[d][1,3]dioxole
2,2-difluoro-5H-cyclopenta[d][1,3]dioxole (PubChem CID 118487457) has the molecular formula C6H4F2O2
and a molecular weight of 146.09 g/mol. Its IUPAC name is 2,2-difluoro-5H-cyclopenta[d][1,3]dioxole.
Molecular Properties
| Compound Name | 2,2-difluoro-5H-cyclopenta[d][1,3]dioxole |
| PubChem CID | 118487457 |
| Molecular Formula | C6H4F2O2 |
| Molecular Weight | 146.09 g/mol |
| Exact Mass | 146.02 |
| IUPAC Name | 2,2-difluoro-5H-cyclopenta[d][1,3]dioxole |
| SMILES | FC1(F)OC2=CCC=C2O1 |
| InChI | InChI=1S/C6H4F2O2/c7-6(8)9-4-2-1-3-5(4)10-6/h2-3H,1H2 |
| InChIKey | PFQWAOQZHDDCHK-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 146.09 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2,2-difluoro-5H-cyclopenta[d][1,3]dioxole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-difluoro-5H-cyclopenta[d][1,3]dioxole?
The IUPAC name of 2,2-difluoro-5H-cyclopenta[d][1,3]dioxole (CID 118487457) is 2,2-difluoro-5H-cyclopenta[d][1,3]dioxole.
What is the SMILES notation for 2,2-difluoro-5H-cyclopenta[d][1,3]dioxole?
The canonical SMILES for 2,2-difluoro-5H-cyclopenta[d][1,3]dioxole is FC1(F)OC2=CCC=C2O1.
What is the InChIKey of 2,2-difluoro-5H-cyclopenta[d][1,3]dioxole?
The InChIKey is PFQWAOQZHDDCHK-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4F2O2/c7-6(8)9-4-2-1-3-5(4)10-6/h2-3H,1H2.
What are the key properties of 2,2-difluoro-5H-cyclopenta[d][1,3]dioxole?
2,2-difluoro-5H-cyclopenta[d][1,3]dioxole has a molecular weight of 146.09 g/mol, XLogP of 1.75, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-difluoro-5H-cyclopenta[d][1,3]dioxole is sourced from PubChem (CID 118487457), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).