C16H22O6 — CID 118487549
4-[(1E,9E)-10-(2-oxo-1,3-dioxolan-4-yl)deca-1,9-dienyl]-1,3-dioxolan-2-one (PubChem CID 118487549) has the molecular formula C16H22O6 and a molecular weight of 310.35 g/mol. Its IUPAC name is 4-[(1E,9E)-10-(2-oxo-1,3-dioxolan-4-yl)deca-1,9-dienyl]-1,3-dioxolan-2-one.
| Compound Name | 4-[(1E,9E)-10-(2-oxo-1,3-dioxolan-4-yl)deca-1,9-dienyl]-1,3-dioxolan-2-one |
|---|---|
| PubChem CID | 118487549 |
| Molecular Formula | C16H22O6 |
| Molecular Weight | 310.35 g/mol |
| Exact Mass | 310.14 |
| IUPAC Name | 4-[(1E,9E)-10-(2-oxo-1,3-dioxolan-4-yl)deca-1,9-dienyl]-1,3-dioxolan-2-one |
| SMILES | O=C1OCC(/C=C/CCCCCC/C=C/C2COC(=O)O2)O1 |
| InChI | InChI=1S/C16H22O6/c17-15-19-11-13(21-15)9-7-5-3-1-2-4-6-8-10-14-12-20-16(18)22-14/h7-10,13-14H,1-6,11-12H2/b9-7+,10-8+ |
| InChIKey | YQPGFKLHHHEICO-FIFLTTCUSA-N |
| XLogP | 3.51 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.35 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|