About 4-(6-methylcyclohexa-2,4-dien-1-yl)butan-2-amine
4-(6-methylcyclohexa-2,4-dien-1-yl)butan-2-amine (PubChem CID 118487625) has the molecular formula C11H19N
and a molecular weight of 165.28 g/mol. Its IUPAC name is 4-(6-methylcyclohexa-2,4-dien-1-yl)butan-2-amine.
Molecular Properties
| Compound Name | 4-(6-methylcyclohexa-2,4-dien-1-yl)butan-2-amine |
| PubChem CID | 118487625 |
| Molecular Formula | C11H19N |
| Molecular Weight | 165.28 g/mol |
| Exact Mass | 165.15 |
| IUPAC Name | 4-(6-methylcyclohexa-2,4-dien-1-yl)butan-2-amine |
| SMILES | CC(N)CCC1C=CC=CC1C |
| InChI | InChI=1S/C11H19N/c1-9-5-3-4-6-11(9)8-7-10(2)12/h3-6,9-11H,7-8,12H2,1-2H3 |
| InChIKey | LLRLPXCOHZVFQO-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.28 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-(6-methylcyclohexa-2,4-dien-1-yl)butan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(6-methylcyclohexa-2,4-dien-1-yl)butan-2-amine?
The IUPAC name of 4-(6-methylcyclohexa-2,4-dien-1-yl)butan-2-amine (CID 118487625) is 4-(6-methylcyclohexa-2,4-dien-1-yl)butan-2-amine.
What is the SMILES notation for 4-(6-methylcyclohexa-2,4-dien-1-yl)butan-2-amine?
The canonical SMILES for 4-(6-methylcyclohexa-2,4-dien-1-yl)butan-2-amine is CC(N)CCC1C=CC=CC1C.
What is the InChIKey of 4-(6-methylcyclohexa-2,4-dien-1-yl)butan-2-amine?
The InChIKey is LLRLPXCOHZVFQO-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H19N/c1-9-5-3-4-6-11(9)8-7-10(2)12/h3-6,9-11H,7-8,12H2,1-2H3.
What are the key properties of 4-(6-methylcyclohexa-2,4-dien-1-yl)butan-2-amine?
4-(6-methylcyclohexa-2,4-dien-1-yl)butan-2-amine has a molecular weight of 165.28 g/mol, XLogP of 2.49, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(6-methylcyclohexa-2,4-dien-1-yl)butan-2-amine is sourced from PubChem (CID 118487625), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).