About (Z)-2-hydroxy-N,N,N'-trimethyl-N'-propylbut-2-enediamide
(Z)-2-hydroxy-N,N,N'-trimethyl-N'-propylbut-2-enediamide (PubChem CID 118488246) has the molecular formula C10H18N2O3
and a molecular weight of 214.26 g/mol. Its IUPAC name is (Z)-2-hydroxy-N,N,N'-trimethyl-N'-propylbut-2-enediamide.
Molecular Properties
| Compound Name | (Z)-2-hydroxy-N,N,N'-trimethyl-N'-propylbut-2-enediamide |
| PubChem CID | 118488246 |
| Molecular Formula | C10H18N2O3 |
| Molecular Weight | 214.26 g/mol |
| Exact Mass | 214.13 |
| IUPAC Name | (Z)-2-hydroxy-N,N,N'-trimethyl-N'-propylbut-2-enediamide |
| SMILES | CCCN(C)C(=O)/C=C(\O)C(=O)N(C)C |
| InChI | InChI=1S/C10H18N2O3/c1-5-6-12(4)9(14)7-8(13)10(15)11(2)3/h7,13H,5-6H2,1-4H3/b8-7- |
| InChIKey | ARJRCGOGGGZDPZ-FPLPWBNLSA-N |
| XLogP | 0.38 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.26 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (Z)-2-hydroxy-N,N,N'-trimethyl-N'-propylbut-2-enediamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-2-hydroxy-N,N,N'-trimethyl-N'-propylbut-2-enediamide?
The IUPAC name of (Z)-2-hydroxy-N,N,N'-trimethyl-N'-propylbut-2-enediamide (CID 118488246) is (Z)-2-hydroxy-N,N,N'-trimethyl-N'-propylbut-2-enediamide.
What is the SMILES notation for (Z)-2-hydroxy-N,N,N'-trimethyl-N'-propylbut-2-enediamide?
The canonical SMILES for (Z)-2-hydroxy-N,N,N'-trimethyl-N'-propylbut-2-enediamide is CCCN(C)C(=O)/C=C(\O)C(=O)N(C)C.
What is the InChIKey of (Z)-2-hydroxy-N,N,N'-trimethyl-N'-propylbut-2-enediamide?
The InChIKey is ARJRCGOGGGZDPZ-FPLPWBNLSA-N. The full InChI is InChI=1S/C10H18N2O3/c1-5-6-12(4)9(14)7-8(13)10(15)11(2)3/h7,13H,5-6H2,1-4H3/b8-7-.
What are the key properties of (Z)-2-hydroxy-N,N,N'-trimethyl-N'-propylbut-2-enediamide?
(Z)-2-hydroxy-N,N,N'-trimethyl-N'-propylbut-2-enediamide has a molecular weight of 214.26 g/mol, XLogP of 0.38, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-2-hydroxy-N,N,N'-trimethyl-N'-propylbut-2-enediamide is sourced from PubChem (CID 118488246), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).